UserName
Extensive quality control produces industry leading bioactivity and lot-to-lot consistency that instills confidence in results and ensures reproducibility. Applications: Bioactivity
Potent, selective inhibitor of TGF-βRI, ALK4 and ALK7
CAS | 301836-41-9 |
---|---|
Empfohlene Lagerung | Bei Raumtemperatur lagern |
Summenformel | C22H16N4O3 |
Formelmasse | 384.39 |
CAS: 1127442-82-3 Summenformel: C25H19N3O3 Molekulargewicht (g/mol): 409.445 InChI-Schlüssel: ZGSXEXBYLJIOGF-HRQSHJORSA-N Synonym: iwr-1-endo,iwr-1 PubChem CID: 91885421 SMILES: C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC6=C5N=CC=C6
InChI-Schlüssel | ZGSXEXBYLJIOGF-HRQSHJORSA-N |
---|---|
PubChem CID | 91885421 |
CAS | 1127442-82-3 |
Molekulargewicht (g/mol) | 409.445 |
SMILES | C1C2C=CC1C3C2C(=O)N(C3=O)C4=CC=C(C=C4)C(=O)NC5=CC=CC6=C5N=CC=C6 |
Synonym | iwr-1-endo,iwr-1 |
Summenformel | C25H19N3O3 |
Chemischer Name oder Material | 4-[2-[4-[(11R)-3,10-Dibromo-8-chloro-6,11-dihydro-5H-benzo[5,6]cyclohepta[1,2-b]pyridin-11-yl]-1-piperidinyl]-2-oxoethyl]-1-piperidinecarboxamide |
---|---|
CAS | 193275-84-2 |
Empfohlene Lagerung | Lagerung bei -20 °C |
Prozentgehaltsbereich | >98% |
Summenformel | C27H31Br2ClN4O2 |
Formelmasse | Observed MW: 638.82 |
Reinheit | 98% |
---|---|
Empfohlene Lagerung | Lagerung bei -20 °C |
Produkttyp | Hemmstoff |
Summenformel | C20H17Cl2N9O2 |
Formelmasse | 486.31 |
Degrades mutant FKBP12F36V fusion proteins; useful alternative to genetic methods for target validation
Chemischer Name oder Material | N-(3-Fluorophenyl)-N'-[4-[[6-(1 H-imidazol-1-yl)-4-pyrimidinyl]amino]phenyl]urea hydrochloride |
---|---|
Reinheit | 0.98 |
Empfohlene Lagerung | Lagerung bei -20 °C |
Summenformel | C20H16FN7O.HCl |
Ziel | Rhot1 |
Voltage-sensitive probe; used to detect changes in membrane potential in electrophysiology protocols
Polarity sensitive lipid membrane fluorescent probe; used for imaging lipid rafts