missing translation for 'onlineSavingsMsg'
Learn More
Learn More
L-Phenylalaninmethylester Hydrochlorid, 99 %, Thermo Scientific Chemicals
CAS: 7524-50-7 | C10H14ClNO2 | 215.68 g/mol
Marke: Thermo Scientific Alfa Aesar A11455.09
64.19 CHF gültig bis 2025-12-31
Benutzen Sie den Promotions-Code "25339" um Ihren Promotions-Preis zu erhalten.
| Menge | 10 g |
|---|
Dieser Artikel kann nicht zurückgegeben werden.
Rückgaberichtlinie anzeigen
Beschreibung
Methyl L-phenylalaninate hydrochloride is used in pharmaceutical, food,animal feed,cosmetic,bio-chemical research etc.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
AnwendungenMethyl-L-Phenylalaninat-Hydrochlorid wird in der pharmazeutischen, Lebensmittel-, Futtermittel-, kosmetischen, biochemischen Forschung usw. verwendet
Löslichkeit
Es ist in Methanol löslich. (5 mg/ml, klare, farblose Lösung)
Hinweise
Kühl lagern. Behälter an einem trockenen und gut belüfteten Ort dicht verschlossen halten. Unverträglich mit starken Oxidationsmitteln. Stabil unter empfohlenen Lagerbedingungen. Hygroskopisch.
Chemische Identifikatoren
| 7524-50-7 | |
| 215.68 | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| 75736 | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 |
| C10H14ClNO2 | |
| MFCD00012489 | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| Methyl (2S)-2-amino-3-phenylpropanoathydrochlorid |
Spezifikation
| L-Phenylalanine methyl ester hydrochloride | |
| 7524-50-7 | |
| MFCD00012489 | |
| l-phenylalanine methyl ester hydrochloride, h-phe-ome.hcl, methyl l-phenylalaninate hydrochloride, s-methyl 2-amino-3-phenylpropanoate hydrochloride, unii-47hk4y94ja, h-phe-ome hcl, h-phe-ome hydrochloride, l-phenylalanine, methyl ester, hydrochloride, l-phenylalanine methyl ester hcl | |
| SWVMLNPDTIFDDY-UHFFFAOYNA-N | |
| Methyl (2S)-2-amino-3-phenylpropanoathydrochlorid | |
| 10 g | |
| 215.68 | |
| Hygroskopisch |
| 158°C to 162°C | |
| C10H14ClNO2 | |
| 3597948 | |
| It is soluble in methanol. (5mg/ ml-clear colorless solution) | |
| [H+].[Cl-].COC(=O)C(N)CC1=CC=CC=C1 | |
| 215.68 | |
| 75736 | |
| +37° (c=2 in ethanol) | |
| 99% |
Zertifikate
Eine Chargennummer ist erforderlich, um Ergebnisse für Zertifikate anzuzeigen. Um Ihre Chargennummer zu früheren Bestellungen zu finden, können Sie unsere Auftragsverfolgung nutzen.
5 Ergebnisse gefunden
| Chargennummer | Art des Zertifikats | Datum | Catalog Number |
|---|---|---|---|
| A0463237 | Analysenzertifikat | 30/08/2024 | A11455.18,A11455.09 |
| A0452269 | Analysenzertifikat | 04/10/2023 | A11455.30,A11455.18,A11455.09 |
| A0441191 | Analysenzertifikat | 05/09/2023 | A11455.30,A11455.18,A11455.09 |
| 10157227 | Analysenzertifikat | 22/11/2021 | A11455.18,A11455.09 |
| C2202C | Analysenzertifikat | 22/11/2021 | A11455.18,A11455.09 |
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts
L-Phenylalaninmethylester Hydrochlorid, 99 %, Thermo Scientific Chemicals > 10 g
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur