missing translation for 'onlineSavingsMsg'
Learn More
Learn More
Gemcitabine hydrochloride, Tocris Bioscience™
DNA synthesis inhibitor
Marke: Tocris Bioscience 3259/50
| Menge | 50 mg |
|---|
Dieser Artikel kann nicht zurückgegeben werden.
Rückgaberichtlinie anzeigen
Beschreibung
Deoxycytidine analog that inhibits DNA synthesis. Metabolized to form gemcitabine triphosphate (dFdCTP) and gemcitabine diphosphate (dFdCDP). dFdCTD inhibits ribonucleotide reductase causing a reduction in cellular nucleotides. dFdCTP is incorporated in DNA resulting in DNA strand termination. Displays antitumor activity in vitro and in vivo.
Chemische Identifikatoren
| 122111-03-9 | |
| 299.659 | |
| gemcitabine hcl, 2',2'-difluorodeoxycytidine monohydrochloride, 2'-deoxy-2',2'-difluorocytidine hydrochloride, 2 1h-pyrimidinone, 4-amino-1-2-deoxy-2,2-difluoro-d-erythro-pentofuranosyl | |
| CHEBI:31647 | |
| [H+].C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F.[Cl-] |
| C9H12ClF2N3O4 | |
| OKKDEIYWILRZIA-OSZBKLCCSA-N | |
| 44558863 | |
| 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydron;chloride |
Spezifikation
| Gemcitabine hydrochloride | |
| C9H12ClF2N3O4 | |
| gemcitabine hcl, 2',2'-difluorodeoxycytidine monohydrochloride, 2'-deoxy-2',2'-difluorocytidine hydrochloride, 2 1h-pyrimidinone, 4-amino-1-2-deoxy-2,2-difluoro-d-erythro-pentofuranosyl | |
| [H+].C1=CN(C(=O)N=C1N)C2C(C(C(O2)CO)O)(F)F.[Cl-] | |
| 299.659 | |
| CHEBI:31647 | |
| >99% |
| 122111-03-9 | |
| 50 mg | |
| OKKDEIYWILRZIA-OSZBKLCCSA-N | |
| 4-amino-1-[(2R,4R,5R)-3,3-difluoro-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrimidin-2-one;hydron;chloride | |
| 44558863 | |
| 299.66 |
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts
Gemcitabine hydrochloride, Tocris Bioscience™ > 50mg
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur