missing translation for 'onlineSavingsMsg'
Learn More
Learn More
(+)-alpha-Pinen, 98 %, Thermo Scientific Chemicals
CAS: 7785-70-8 | C10H16 | 136.24 g/mol
Marke: Thermo Scientific Alfa Aesar L04941.18
55.53 CHF gültig bis 2025-12-31
Benutzen Sie den Promotions-Code "25339" um Ihren Promotions-Preis zu erhalten.
| Menge | 50 g |
|---|
Dieser Artikel kann nicht zurückgegeben werden.
Rückgaberichtlinie anzeigen
Beschreibung
(+)-alpha-Pinene is employed in the preparation of chiral hydroboration reagents. It is a bronchodilator in humans. α-Pinene is an anti-inflammatory and used as a broad-spectrum antibiotic.It exhibits activity as an acetylcholinesterase inhibitor, aiding memory. It is a biosynthetic base for CB2 ligands, such as HU-308.
This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Scientific Chemicals.
Anwendungen(+)-alpha-Pinen wird bei der Herstellung chiraler Hydroborationsreagenzien verwendet. Es dient bei Menschen als Bronchodilatator. α-Pinen ist entzündungshemmend und wird als Breitbandantibiotikum verwendet. Es wirkt als Acetylcholinesterase-Inhibitor und unterstützt das Gedächtnis. Es ist eine biosynthetische Basis für CB2-Liganden, wie z. B. HU-308.
Löslichkeit
Löslich in Äther, Alkoholen und Chloroform. Nicht mit Wasser mischbar.
Hinweise
Inkompatible Materialien sind starke Oxidationsmittel. Kühl lagern. Behälter an einem trockenen und gut belüfteten Ort dicht verschlossen halten.
Chemische Identifikatoren
| 7785-70-8 | |
| 136.24 | |
| GRWFGVWFFZKLTI-RKDXNWHRSA-N | |
| 82227 | |
| (1R,5R)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en |
| C10H16 | |
| MFCD00001346 | |
| +-alpha-pinene, 1r,5r-2,6,6-trimethylbicyclo 3.1.1 hept-2-ene, 1r-+-alpha-pinene, 1r,5r-alpha-pinene, unii-h6cm4twh1w, +-pinene, h6cm4twh1w, 1r,5r-2-pinene, bicyclo 3.1.1 hept-2-ene, 2,6,6-trimethyl-, 1r,5r, +-pin-2 3-ene | |
| CHEBI:28261 | |
| CC1=CC[C@@H]2C[C@H]1C2(C)C |
Spezifikation
| (+)-alpha-Pinene | |
| -62°C | |
| 154°C to 156°C | |
| C10H16 | |
| MFCD00001346 | |
| UN2368 | |
| 14,7445 | |
| Soluble in Ether,Alcohols,Chloroform. Not miscible in water. | |
| CC1=CC[C@@H]2C[C@H]1C2(C)C | |
| 136.24 | |
| CHEBI:28261 | |
| 98% |
| 7785-70-8 | |
| 0.858 | |
| 32°C (89°F) | |
| 1.466 | |
| 50 g | |
| 3648264 | |
| +-alpha-pinene, 1r,5r-2,6,6-trimethylbicyclo 3.1.1 hept-2-ene, 1r-+-alpha-pinene, 1r,5r-alpha-pinene, unii-h6cm4twh1w, +-pinene, h6cm4twh1w, 1r,5r-2-pinene, bicyclo 3.1.1 hept-2-ene, 2,6,6-trimethyl-, 1r,5r, +-pin-2 3-ene | |
| GRWFGVWFFZKLTI-RKDXNWHRSA-N | |
| (1R,5R)-4,6,6-Trimethylbicyclo[3.1.1]hept-3-en | |
| 82227 | |
| 136.24 |
Zertifikate
Eine Chargennummer ist erforderlich, um Ergebnisse für Zertifikate anzuzeigen. Um Ihre Chargennummer zu früheren Bestellungen zu finden, können Sie unsere Auftragsverfolgung nutzen.
5 Ergebnisse gefunden
| Chargennummer | Art des Zertifikats | Datum | Catalog Number |
|---|---|---|---|
| 10252386 | Analysenzertifikat | 18/09/2024 | L04941.30,L04941.18 |
| 10249183 | Analysenzertifikat | 25/12/2023 | L04941.30,L04941.18 |
| 10248701 | Analysenzertifikat | 22/11/2023 | L04941.30,L04941.18 |
| 10220225 | Analysenzertifikat | 11/10/2023 | L04941.30,L04941.18 |
| 10236369 | Analysenzertifikat | 11/10/2023 | L04941.30,L04941.18 |
Berichtigung von Produktinhalten
Bitte geben Sie uns Ihr Feedback zu den Produktinhalten, indem Sie das folgende Formular ausfüllen.
Name des Produkts
(+)-alpha-Pinen, 98 %, Thermo Scientific Chemicals > 50 g
Haben Sie Verbesserungsvorschläge?Übermitteln Sie eine inhaltliche Korrektur